C18H20N2O6 — CID 19031539
dimethyl 4-methyl-6-(methylamino)-2-(3-nitrophenyl)cyclohexa-3,6-diene-1,3-dicarboxylate (PubChem CID 19031539) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is dimethyl 4-methyl-6-(methylamino)-2-(3-nitrophenyl)cyclohexa-3,6-diene-1,3-dicarboxylate.
| Compound Name | dimethyl 4-methyl-6-(methylamino)-2-(3-nitrophenyl)cyclohexa-3,6-diene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 19031539 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | dimethyl 4-methyl-6-(methylamino)-2-(3-nitrophenyl)cyclohexa-3,6-diene-1,3-dicarboxylate |
| SMILES | CNC1=C(C(=O)OC)C(c2cccc([N+](=O)[O-])c2)C(C(=O)OC)=C(C)C1 |
| InChI | InChI=1S/C18H20N2O6/c1-10-8-13(19-2)16(18(22)26-4)15(14(10)17(21)25-3)11-6-5-7-12(9-11)20(23)24/h5-7,9,15,19H,8H2,1-4H3 |
| InChIKey | SKKRMJJARVELPV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|