About methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate
methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 19032164) has the molecular formula C33H30O5S2
and a molecular weight of 570.73 g/mol. Its IUPAC name is methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate.
Molecular Properties
| Compound Name | methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate |
| PubChem CID | 19032164 |
| Molecular Formula | C33H30O5S2 |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1c2c(c3ccccc3c1C1SCCCS1)OC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C=C2 |
| InChI | InChI=1S/C33H30O5S2/c1-35-23-13-9-21(10-14-23)33(22-11-15-24(36-2)16-12-22)18-17-27-28(31(34)37-3)29(32-39-19-6-20-40-32)25-7-4-5-8-26(25)30(27)38-33/h4-5,7-18,32H,6,19-20H2,1-3H3 |
| InChIKey | UPGZEIPVAIZLHI-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The IUPAC name of methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate (CID 19032164) is methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate.
What is the SMILES notation for methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The canonical SMILES for methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate is COC(=O)c1c2c(c3ccccc3c1C1SCCCS1)OC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C=C2.
What is the InChIKey of methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
The InChIKey is UPGZEIPVAIZLHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H30O5S2/c1-35-23-13-9-21(10-14-23)33(22-11-15-24(36-2)16-12-22)18-17-27-28(31(34)37-3)29(32-39-19-6-20-40-32)25-7-4-5-8-26(25)30(27)38-33/h4-5,7-18,32H,6,19-20H2,1-3H3.
What are the key properties of methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate?
methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate has a molecular weight of 570.73 g/mol, XLogP of 7.86, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-(1,3-dithian-2-yl)-2,2-bis(4-methoxyphenyl)benzo[h]chromene-5-carboxylate is sourced from PubChem (CID 19032164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).