C19H14F26OS — CID 19032293
6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)undecan-3-ol (PubChem CID 19032293) has the molecular formula C19H14F26OS and a molecular weight of 784.33 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)undecan-3-ol.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)undecan-3-ol |
|---|---|
| PubChem CID | 19032293 |
| Molecular Formula | C19H14F26OS |
| Molecular Weight | 784.33 g/mol |
| Exact Mass | 784.04 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-1-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylsulfanyl)undecan-3-ol |
| SMILES | OC(CCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H14F26OS/c20-8(21,10(24,25)12(28,29)14(32,33)16(36,37)18(40,41)42)3-1-7(46)2-5-47-6-4-9(22,23)11(26,27)13(30,31)15(34,35)17(38,39)19(43,44)45/h7,46H,1-6H2 |
| InChIKey | NXDGIQPFPRSOCE-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.33 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|