C17H19N4O3- — CID 19032426
N-[4-[4-(5-methoxy-2-pyridinyl)piperazin-1-yl]phenyl]carbamate (PubChem CID 19032426) has the molecular formula C17H19N4O3- and a molecular weight of 327.36 g/mol. Its IUPAC name is N-[4-[4-(5-methoxy-2-pyridinyl)piperazin-1-yl]phenyl]carbamate.
| Compound Name | N-[4-[4-(5-methoxy-2-pyridinyl)piperazin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 19032426 |
| Molecular Formula | C17H19N4O3- |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-[4-[4-(5-methoxy-2-pyridinyl)piperazin-1-yl]phenyl]carbamate |
| SMILES | COc1ccc(N2CCN(c3ccc(NC(=O)[O-])cc3)CC2)nc1 |
| InChI | InChI=1S/C17H20N4O3/c1-24-15-6-7-16(18-12-15)21-10-8-20(9-11-21)14-4-2-13(3-5-14)19-17(22)23/h2-7,12,19H,8-11H2,1H3,(H,22,23)/p-1 |
| InChIKey | FEEAFDPETJAATO-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|