About 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride
4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride (PubChem CID 19032464) has the molecular formula C16H14ClN3
and a molecular weight of 283.76 g/mol. Its IUPAC name is 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride.
Molecular Properties
| Compound Name | 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride |
| PubChem CID | 19032464 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride |
| SMILES | Cc1nc2ccccn2c1Cc1ccc(C#N)cc1.Cl |
| InChI | InChI=1S/C16H13N3.ClH/c1-12-15(19-9-3-2-4-16(19)18-12)10-13-5-7-14(11-17)8-6-13;/h2-9H,10H2,1H3;1H |
| InChIKey | HSCFJYIINJMNQE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride?
The IUPAC name of 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride (CID 19032464) is 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride.
What is the SMILES notation for 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride?
The canonical SMILES for 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride is Cc1nc2ccccn2c1Cc1ccc(C#N)cc1.Cl.
What is the InChIKey of 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride?
The InChIKey is HSCFJYIINJMNQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3.ClH/c1-12-15(19-9-3-2-4-16(19)18-12)10-13-5-7-14(11-17)8-6-13;/h2-9H,10H2,1H3;1H.
What are the key properties of 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride?
4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride has a molecular weight of 283.76 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methylimidazo[1,2-a]pyridin-3-yl)methyl]benzonitrile;hydrochloride is sourced from PubChem (CID 19032464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).