C20H34N2O2 — CID 19032574
ethyl 4-(decan-2-ylamino)-2,6-dimethylpyridine-3-carboxylate (PubChem CID 19032574) has the molecular formula C20H34N2O2 and a molecular weight of 334.50 g/mol. Its IUPAC name is ethyl 4-(decan-2-ylamino)-2,6-dimethylpyridine-3-carboxylate.
| Compound Name | ethyl 4-(decan-2-ylamino)-2,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 19032574 |
| Molecular Formula | C20H34N2O2 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | ethyl 4-(decan-2-ylamino)-2,6-dimethylpyridine-3-carboxylate |
| SMILES | CCCCCCCCC(C)Nc1cc(C)nc(C)c1C(=O)OCC |
| InChI | InChI=1S/C20H34N2O2/c1-6-8-9-10-11-12-13-15(3)22-18-14-16(4)21-17(5)19(18)20(23)24-7-2/h14-15H,6-13H2,1-5H3,(H,21,22) |
| InChIKey | UKKFGBQQOCJLDF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|