C36H30N2O4 — CID 19033230
16-(2,5-ditert-butylphenyl)-5-nitro-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione (PubChem CID 19033230) has the molecular formula C36H30N2O4 and a molecular weight of 554.65 g/mol. Its IUPAC name is 16-(2,5-ditert-butylphenyl)-5-nitro-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione.
| Compound Name | 16-(2,5-ditert-butylphenyl)-5-nitro-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
|---|---|
| PubChem CID | 19033230 |
| Molecular Formula | C36H30N2O4 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 16-(2,5-ditert-butylphenyl)-5-nitro-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2,4,6,8,10(23),11(21),12,14(22),18-decaene-15,17-dione |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(N2C(=O)c3ccc4c5cccc6c([N+](=O)[O-])ccc(c7ccc(c3c47)C2=O)c65)c1 |
| InChI | InChI=1S/C36H30N2O4/c1-35(2,3)19-10-16-27(36(4,5)6)29(18-19)37-33(39)25-13-11-22-20-8-7-9-24-28(38(41)42)17-15-21(30(20)24)23-12-14-26(34(37)40)32(25)31(22)23/h7-18H,1-6H3 |
| InChIKey | MVZZMAYFVAOVTM-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|