C16H30O2 — CID 19033533
3,4,4,5-tetramethyldodec-1-yne-1,3-diol (PubChem CID 19033533) has the molecular formula C16H30O2 and a molecular weight of 254.41 g/mol. Its IUPAC name is 3,4,4,5-tetramethyldodec-1-yne-1,3-diol.
| Compound Name | 3,4,4,5-tetramethyldodec-1-yne-1,3-diol |
|---|---|
| PubChem CID | 19033533 |
| Molecular Formula | C16H30O2 |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 3,4,4,5-tetramethyldodec-1-yne-1,3-diol |
| SMILES | CCCCCCCC(C)C(C)(C)C(C)(O)C#CO |
| InChI | InChI=1S/C16H30O2/c1-6-7-8-9-10-11-14(2)15(3,4)16(5,18)12-13-17/h14,17-18H,6-11H2,1-5H3 |
| InChIKey | CNNLHQFHFVQVHY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|