C6H5F7O — CID 19033536
4-ethenoxy-1,1,1,2,2,3,3-heptafluorobutane (PubChem CID 19033536) has the molecular formula C6H5F7O and a molecular weight of 226.09 g/mol. Its IUPAC name is 4-ethenoxy-1,1,1,2,2,3,3-heptafluorobutane.
| Compound Name | 4-ethenoxy-1,1,1,2,2,3,3-heptafluorobutane |
|---|---|
| PubChem CID | 19033536 |
| Molecular Formula | C6H5F7O |
| Molecular Weight | 226.09 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 4-ethenoxy-1,1,1,2,2,3,3-heptafluorobutane |
| SMILES | C=COCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H5F7O/c1-2-14-3-4(7,8)5(9,10)6(11,12)13/h2H,1,3H2 |
| InChIKey | UDAAMHMYEJUEDJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.09 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|