C24H21F3O6S — CID 19035106
ethyl 4-[2-[5,5-dimethyl-4-oxo-8-(trifluoromethylsulfonyloxy)-4a,6-dihydronaphthalen-2-yl]ethynyl]benzoate (PubChem CID 19035106) has the molecular formula C24H21F3O6S and a molecular weight of 494.49 g/mol. Its IUPAC name is ethyl 4-[2-[5,5-dimethyl-4-oxo-8-(trifluoromethylsulfonyloxy)-4a,6-dihydronaphthalen-2-yl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[5,5-dimethyl-4-oxo-8-(trifluoromethylsulfonyloxy)-4a,6-dihydronaphthalen-2-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 19035106 |
| Molecular Formula | C24H21F3O6S |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | ethyl 4-[2-[5,5-dimethyl-4-oxo-8-(trifluoromethylsulfonyloxy)-4a,6-dihydronaphthalen-2-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#CC2=CC(=O)C3C(=C2)C(OS(=O)(=O)C(F)(F)F)=CCC3(C)C)cc1 |
| InChI | InChI=1S/C24H21F3O6S/c1-4-32-22(29)17-9-7-15(8-10-17)5-6-16-13-18-20(33-34(30,31)24(25,26)27)11-12-23(2,3)21(18)19(28)14-16/h7-11,13-14,21H,4,12H2,1-3H3 |
| InChIKey | FIXFEPVLGHXEOP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|