C9H16F7NO3S — CID 19035142
1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;triethylazanium (PubChem CID 19035142) has the molecular formula C9H16F7NO3S and a molecular weight of 351.28 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;triethylazanium.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;triethylazanium |
|---|---|
| PubChem CID | 19035142 |
| Molecular Formula | C9H16F7NO3S |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H15N.C3HF7O3S/c1-4-7(5-2)6-3;4-1(5,2(6,7)8)3(9,10)14(11,12)13/h4-6H2,1-3H3;(H,11,12,13) |
| InChIKey | AQRXOCYBPHFTLJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|