About 4H-indeno[1,2-b]pyrazine-3,9-dione
4H-indeno[1,2-b]pyrazine-3,9-dione (PubChem CID 19035976) has the molecular formula C11H6N2O2
and a molecular weight of 198.18 g/mol. Its IUPAC name is 4H-indeno[1,2-b]pyrazine-3,9-dione.
Molecular Properties
| Compound Name | 4H-indeno[1,2-b]pyrazine-3,9-dione |
| PubChem CID | 19035976 |
| Molecular Formula | C11H6N2O2 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 4H-indeno[1,2-b]pyrazine-3,9-dione |
| SMILES | O=C1c2ccccc2-c2[nH]c(=O)cnc21 |
| InChI | InChI=1S/C11H6N2O2/c14-8-5-12-10-9(13-8)6-3-1-2-4-7(6)11(10)15/h1-5H,(H,13,14) |
| InChIKey | YHKXHPNZMPPLAN-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4H-indeno[1,2-b]pyrazine-3,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-indeno[1,2-b]pyrazine-3,9-dione?
The IUPAC name of 4H-indeno[1,2-b]pyrazine-3,9-dione (CID 19035976) is 4H-indeno[1,2-b]pyrazine-3,9-dione.
What is the SMILES notation for 4H-indeno[1,2-b]pyrazine-3,9-dione?
The canonical SMILES for 4H-indeno[1,2-b]pyrazine-3,9-dione is O=C1c2ccccc2-c2[nH]c(=O)cnc21.
What is the InChIKey of 4H-indeno[1,2-b]pyrazine-3,9-dione?
The InChIKey is YHKXHPNZMPPLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O2/c14-8-5-12-10-9(13-8)6-3-1-2-4-7(6)11(10)15/h1-5H,(H,13,14).
What are the key properties of 4H-indeno[1,2-b]pyrazine-3,9-dione?
4H-indeno[1,2-b]pyrazine-3,9-dione has a molecular weight of 198.18 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-indeno[1,2-b]pyrazine-3,9-dione is sourced from PubChem (CID 19035976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).