About 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one
2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (PubChem CID 19036380) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| PubChem CID | 19036380 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| SMILES | C/C=C/CC1Cc2cc(OC)c(OC)cc2C1=O |
| InChI | InChI=1S/C15H18O3/c1-4-5-6-10-7-11-8-13(17-2)14(18-3)9-12(11)15(10)16/h4-5,8-10H,6-7H2,1-3H3/b5-4+ |
| InChIKey | XQOVKGGYVPBNNJ-SNAWJCMRSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one?
The IUPAC name of 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (CID 19036380) is 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one.
What is the SMILES notation for 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one?
The canonical SMILES for 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one is C/C=C/CC1Cc2cc(OC)c(OC)cc2C1=O.
What is the InChIKey of 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one?
The InChIKey is XQOVKGGYVPBNNJ-SNAWJCMRSA-N. The full InChI is InChI=1S/C15H18O3/c1-4-5-6-10-7-11-8-13(17-2)14(18-3)9-12(11)15(10)16/h4-5,8-10H,6-7H2,1-3H3/b5-4+.
What are the key properties of 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one?
2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one has a molecular weight of 246.31 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-but-2-enyl]-5,6-dimethoxy-2,3-dihydroinden-1-one is sourced from PubChem (CID 19036380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).