About 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene
6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene (PubChem CID 19036887) has the molecular formula C18H19F
and a molecular weight of 254.35 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| PubChem CID | 19036887 |
| Molecular Formula | C18H19F |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene |
| SMILES | CC1(C)CCCc2ccc(-c3ccccc3F)cc21 |
| InChI | InChI=1S/C18H19F/c1-18(2)11-5-6-13-9-10-14(12-16(13)18)15-7-3-4-8-17(15)19/h3-4,7-10,12H,5-6,11H2,1-2H3 |
| InChIKey | LIQDYHRBEUNDAM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The IUPAC name of 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene (CID 19036887) is 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The canonical SMILES for 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene is CC1(C)CCCc2ccc(-c3ccccc3F)cc21.
What is the InChIKey of 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
The InChIKey is LIQDYHRBEUNDAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F/c1-18(2)11-5-6-13-9-10-14(12-16(13)18)15-7-3-4-8-17(15)19/h3-4,7-10,12H,5-6,11H2,1-2H3.
What are the key properties of 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene?
6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene has a molecular weight of 254.35 g/mol, XLogP of 5.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluorophenyl)-4,4-dimethyl-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 19036887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).