C15H14FN3O4 — CID 19037052
N-(2-cyanoethyl)-2-(fluoromethyl)-2-methyl-6-nitrochromene-4-carboxamide (PubChem CID 19037052) has the molecular formula C15H14FN3O4 and a molecular weight of 319.29 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(fluoromethyl)-2-methyl-6-nitrochromene-4-carboxamide.
| Compound Name | N-(2-cyanoethyl)-2-(fluoromethyl)-2-methyl-6-nitrochromene-4-carboxamide |
|---|---|
| PubChem CID | 19037052 |
| Molecular Formula | C15H14FN3O4 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(2-cyanoethyl)-2-(fluoromethyl)-2-methyl-6-nitrochromene-4-carboxamide |
| SMILES | CC1(CF)C=C(C(=O)NCCC#N)c2cc([N+](=O)[O-])ccc2O1 |
| InChI | InChI=1S/C15H14FN3O4/c1-15(9-16)8-12(14(20)18-6-2-5-17)11-7-10(19(21)22)3-4-13(11)23-15/h3-4,7-8H,2,6,9H2,1H3,(H,18,20) |
| InChIKey | BQDKJLPXNCMOPC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|