About 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol
5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 19037265) has the molecular formula C15H13ClO
and a molecular weight of 244.72 g/mol. Its IUPAC name is 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 19037265 |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CC(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H13ClO/c16-11-6-7-12-14(8-11)13(9-15(12)17)10-4-2-1-3-5-10/h1-8,13,15,17H,9H2 |
| InChIKey | VUDDHWYKLGXWRZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol (CID 19037265) is 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol is OC1CC(c2ccccc2)c2cc(Cl)ccc21.
What is the InChIKey of 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is VUDDHWYKLGXWRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClO/c16-11-6-7-12-14(8-11)13(9-15(12)17)10-4-2-1-3-5-10/h1-8,13,15,17H,9H2.
What are the key properties of 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol?
5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 244.72 g/mol, XLogP of 3.91, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-phenyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 19037265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).