About 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine
1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine (PubChem CID 19037341) has the molecular formula C11H28N4
and a molecular weight of 216.37 g/mol. Its IUPAC name is 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine |
| PubChem CID | 19037341 |
| Molecular Formula | C11H28N4 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.23 |
| IUPAC Name | 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine |
| SMILES | CCC(N)NC(CC)NC(CC)N(C)C |
| InChI | InChI=1S/C11H28N4/c1-6-9(12)13-10(7-2)14-11(8-3)15(4)5/h9-11,13-14H,6-8,12H2,1-5H3 |
| InChIKey | NKTTXUBFOSVWSS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine?
The IUPAC name of 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine (CID 19037341) is 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine.
What is the SMILES notation for 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine?
The canonical SMILES for 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine is CCC(N)NC(CC)NC(CC)N(C)C.
What is the InChIKey of 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine?
The InChIKey is NKTTXUBFOSVWSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28N4/c1-6-9(12)13-10(7-2)14-11(8-3)15(4)5/h9-11,13-14H,6-8,12H2,1-5H3.
What are the key properties of 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine?
1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine has a molecular weight of 216.37 g/mol, XLogP of 0.89, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-[1-[1-(dimethylamino)propylamino]propyl]propane-1,1-diamine is sourced from PubChem (CID 19037341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).