About pyrano[4,3-b]indole-1,3-dione
pyrano[4,3-b]indole-1,3-dione (PubChem CID 19037542) has the molecular formula C11H5NO3
and a molecular weight of 199.16 g/mol. Its IUPAC name is pyrano[4,3-b]indole-1,3-dione.
Molecular Properties
| Compound Name | pyrano[4,3-b]indole-1,3-dione |
| PubChem CID | 19037542 |
| Molecular Formula | C11H5NO3 |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | pyrano[4,3-b]indole-1,3-dione |
| SMILES | O=C1C=C2N=c3ccccc3=C2C(=O)O1 |
| InChI | InChI=1S/C11H5NO3/c13-9-5-8-10(11(14)15-9)6-3-1-2-4-7(6)12-8/h1-5H |
| InChIKey | XESBCHDTCWYWES-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze pyrano[4,3-b]indole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrano[4,3-b]indole-1,3-dione?
The IUPAC name of pyrano[4,3-b]indole-1,3-dione (CID 19037542) is pyrano[4,3-b]indole-1,3-dione.
What is the SMILES notation for pyrano[4,3-b]indole-1,3-dione?
The canonical SMILES for pyrano[4,3-b]indole-1,3-dione is O=C1C=C2N=c3ccccc3=C2C(=O)O1.
What is the InChIKey of pyrano[4,3-b]indole-1,3-dione?
The InChIKey is XESBCHDTCWYWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5NO3/c13-9-5-8-10(11(14)15-9)6-3-1-2-4-7(6)12-8/h1-5H.
What are the key properties of pyrano[4,3-b]indole-1,3-dione?
pyrano[4,3-b]indole-1,3-dione has a molecular weight of 199.16 g/mol, XLogP of -0.56, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrano[4,3-b]indole-1,3-dione is sourced from PubChem (CID 19037542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).