C16H13BrFNO — CID 19037743
3-bromo-5-(4-fluorophenyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 19037743) has the molecular formula C16H13BrFNO and a molecular weight of 334.19 g/mol. Its IUPAC name is 3-bromo-5-(4-fluorophenyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 3-bromo-5-(4-fluorophenyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 19037743 |
| Molecular Formula | C16H13BrFNO |
| Molecular Weight | 334.19 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 3-bromo-5-(4-fluorophenyl)-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2C(c2ccc(F)cc2)CC1Br |
| InChI | InChI=1S/C16H13BrFNO/c17-14-9-13(10-5-7-11(18)8-6-10)12-3-1-2-4-15(12)19-16(14)20/h1-8,13-14H,9H2,(H,19,20) |
| InChIKey | JYHQXEZRVQYUNX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|