About 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride
3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride (PubChem CID 19038091) has the molecular formula C15H19ClN2O2
and a molecular weight of 294.78 g/mol. Its IUPAC name is 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride |
| PubChem CID | 19038091 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride |
| SMILES | CN1CCCC(Oc2cc(-c3ccccc3)on2)C1.Cl |
| InChI | InChI=1S/C15H18N2O2.ClH/c1-17-9-5-8-13(11-17)18-15-10-14(19-16-15)12-6-3-2-4-7-12;/h2-4,6-7,10,13H,5,8-9,11H2,1H3;1H |
| InChIKey | ZOEIDWRQFVJMMH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride?
The IUPAC name of 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride (CID 19038091) is 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride.
What is the SMILES notation for 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride?
The canonical SMILES for 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride is CN1CCCC(Oc2cc(-c3ccccc3)on2)C1.Cl.
What is the InChIKey of 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride?
The InChIKey is ZOEIDWRQFVJMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2.ClH/c1-17-9-5-8-13(11-17)18-15-10-14(19-16-15)12-6-3-2-4-7-12;/h2-4,6-7,10,13H,5,8-9,11H2,1H3;1H.
What are the key properties of 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride?
3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride has a molecular weight of 294.78 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylpiperidin-3-yl)oxy-5-phenyl-1,2-oxazole;hydrochloride is sourced from PubChem (CID 19038091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).