C19H14F6O4 — CID 19038420
4-[2,2,3,3,4,4-hexafluoro-5-(4-formylphenoxy)pentoxy]benzaldehyde (PubChem CID 19038420) has the molecular formula C19H14F6O4 and a molecular weight of 420.31 g/mol. Its IUPAC name is 4-[2,2,3,3,4,4-hexafluoro-5-(4-formylphenoxy)pentoxy]benzaldehyde.
| Compound Name | 4-[2,2,3,3,4,4-hexafluoro-5-(4-formylphenoxy)pentoxy]benzaldehyde |
|---|---|
| PubChem CID | 19038420 |
| Molecular Formula | C19H14F6O4 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 4-[2,2,3,3,4,4-hexafluoro-5-(4-formylphenoxy)pentoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OCC(F)(F)C(F)(F)C(F)(F)COc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C19H14F6O4/c20-17(21,11-28-15-5-1-13(9-26)2-6-15)19(24,25)18(22,23)12-29-16-7-3-14(10-27)4-8-16/h1-10H,11-12H2 |
| InChIKey | FFAANOACJMWJEI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|