C40H36N4O6 — CID 19038432
1-phenylmethoxy-3-[[4-[7-[4-[(phenylmethoxycarbamoylamino)methyl]phenoxy]naphthalen-2-yl]oxyphenyl]methyl]urea (PubChem CID 19038432) has the molecular formula C40H36N4O6 and a molecular weight of 668.75 g/mol. Its IUPAC name is 1-phenylmethoxy-3-[[4-[7-[4-[(phenylmethoxycarbamoylamino)methyl]phenoxy]naphthalen-2-yl]oxyphenyl]methyl]urea.
| Compound Name | 1-phenylmethoxy-3-[[4-[7-[4-[(phenylmethoxycarbamoylamino)methyl]phenoxy]naphthalen-2-yl]oxyphenyl]methyl]urea |
|---|---|
| PubChem CID | 19038432 |
| Molecular Formula | C40H36N4O6 |
| Molecular Weight | 668.75 g/mol |
| Exact Mass | 668.26 |
| IUPAC Name | 1-phenylmethoxy-3-[[4-[7-[4-[(phenylmethoxycarbamoylamino)methyl]phenoxy]naphthalen-2-yl]oxyphenyl]methyl]urea |
| SMILES | O=C(NCc1ccc(Oc2ccc3ccc(Oc4ccc(CNC(=O)NOCc5ccccc5)cc4)cc3c2)cc1)NOCc1ccccc1 |
| InChI | InChI=1S/C40H36N4O6/c45-39(43-47-27-31-7-3-1-4-8-31)41-25-29-11-17-35(18-12-29)49-37-21-15-33-16-22-38(24-34(33)23-37)50-36-19-13-30(14-20-36)26-42-40(46)44-48-28-32-9-5-2-6-10-32/h1-24H,25-28H2,(H2,41,43,45)(H2,42,44,46) |
| InChIKey | PXMUVDUQNGQTDW-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.75 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|