C19H20F6N2O4 — CID 19038469
N-[[4-[2,2,3,3,4,4-hexafluoro-5-[4-[(hydroxyamino)methyl]phenoxy]pentoxy]phenyl]methyl]hydroxylamine (PubChem CID 19038469) has the molecular formula C19H20F6N2O4 and a molecular weight of 454.37 g/mol. Its IUPAC name is N-[[4-[2,2,3,3,4,4-hexafluoro-5-[4-[(hydroxyamino)methyl]phenoxy]pentoxy]phenyl]methyl]hydroxylamine.
| Compound Name | N-[[4-[2,2,3,3,4,4-hexafluoro-5-[4-[(hydroxyamino)methyl]phenoxy]pentoxy]phenyl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 19038469 |
| Molecular Formula | C19H20F6N2O4 |
| Molecular Weight | 454.37 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | N-[[4-[2,2,3,3,4,4-hexafluoro-5-[4-[(hydroxyamino)methyl]phenoxy]pentoxy]phenyl]methyl]hydroxylamine |
| SMILES | ONCc1ccc(OCC(F)(F)C(F)(F)C(F)(F)COc2ccc(CNO)cc2)cc1 |
| InChI | InChI=1S/C19H20F6N2O4/c20-17(21,11-30-15-5-1-13(2-6-15)9-26-28)19(24,25)18(22,23)12-31-16-7-3-14(4-8-16)10-27-29/h1-8,26-29H,9-12H2 |
| InChIKey | XOOVNCPXYGFDAR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|