C25H22F2N2O2S — CID 19039967
2-[(3-aminophenyl)methyl]-7-[(5,6-difluoro-1,3-benzothiazol-2-yl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 19039967) has the molecular formula C25H22F2N2O2S and a molecular weight of 452.53 g/mol. Its IUPAC name is 2-[(3-aminophenyl)methyl]-7-[(5,6-difluoro-1,3-benzothiazol-2-yl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 2-[(3-aminophenyl)methyl]-7-[(5,6-difluoro-1,3-benzothiazol-2-yl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 19039967 |
| Molecular Formula | C25H22F2N2O2S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 2-[(3-aminophenyl)methyl]-7-[(5,6-difluoro-1,3-benzothiazol-2-yl)methoxy]-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | Nc1cccc(CC2CCc3ccc(OCc4nc5cc(F)c(F)cc5s4)cc3C2O)c1 |
| InChI | InChI=1S/C25H22F2N2O2S/c26-20-11-22-23(12-21(20)27)32-24(29-22)13-31-18-7-6-15-4-5-16(25(30)19(15)10-18)8-14-2-1-3-17(28)9-14/h1-3,6-7,9-12,16,25,30H,4-5,8,13,28H2 |
| InChIKey | HYCFTLJTKPFSKN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|