C12H17NO5 — CID 19040047
3-O-ethyl 2-O-methyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate (PubChem CID 19040047) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 3-O-ethyl 2-O-methyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate.
| Compound Name | 3-O-ethyl 2-O-methyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 19040047 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 3-O-ethyl 2-O-methyl 4-oxo-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1C2C(=O)CCC2CN1C(=O)OC |
| InChI | InChI=1S/C12H17NO5/c1-3-18-11(15)10-9-7(4-5-8(9)14)6-13(10)12(16)17-2/h7,9-10H,3-6H2,1-2H3 |
| InChIKey | YDTNOUHJCJPKCZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |