C20H22N4O3 — CID 19040690
1-[5-(4-aminophenyl)-8-methyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]-2-(methylamino)ethanone (PubChem CID 19040690) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-[5-(4-aminophenyl)-8-methyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]-2-(methylamino)ethanone.
| Compound Name | 1-[5-(4-aminophenyl)-8-methyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]-2-(methylamino)ethanone |
|---|---|
| PubChem CID | 19040690 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[5-(4-aminophenyl)-8-methyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]-2-(methylamino)ethanone |
| SMILES | CNCC(=O)N1N=C(c2ccc(N)cc2)c2cc3c(cc2CC1C)OOC3 |
| InChI | InChI=1S/C20H22N4O3/c1-12-7-14-9-18-15(11-26-27-18)8-17(14)20(13-3-5-16(21)6-4-13)23-24(12)19(25)10-22-2/h3-6,8-9,12,22H,7,10-11,21H2,1-2H3 |
| InChIKey | GNFMPABDQNZNJQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|