C22H23N3O4 — CID 19040691
N-[4-(8-methyl-7-propanoyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-5-yl)phenyl]acetamide (PubChem CID 19040691) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[4-(8-methyl-7-propanoyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-5-yl)phenyl]acetamide.
| Compound Name | N-[4-(8-methyl-7-propanoyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 19040691 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[4-(8-methyl-7-propanoyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-5-yl)phenyl]acetamide |
| SMILES | CCC(=O)N1N=C(c2ccc(NC(C)=O)cc2)c2cc3c(cc2CC1C)OOC3 |
| InChI | InChI=1S/C22H23N3O4/c1-4-21(27)25-13(2)9-16-11-20-17(12-28-29-20)10-19(16)22(24-25)15-5-7-18(8-6-15)23-14(3)26/h5-8,10-11,13H,4,9,12H2,1-3H3,(H,23,26) |
| InChIKey | FZPOCYCLYWGSLK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|