C17H15N3O4 — CID 19040696
8-methyl-5-(4-nitrophenyl)-3,7,8,9-tetrahydrodioxolo[3,4-h][2,3]benzodiazepine (PubChem CID 19040696) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is 8-methyl-5-(4-nitrophenyl)-3,7,8,9-tetrahydrodioxolo[3,4-h][2,3]benzodiazepine.
| Compound Name | 8-methyl-5-(4-nitrophenyl)-3,7,8,9-tetrahydrodioxolo[3,4-h][2,3]benzodiazepine |
|---|---|
| PubChem CID | 19040696 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | 8-methyl-5-(4-nitrophenyl)-3,7,8,9-tetrahydrodioxolo[3,4-h][2,3]benzodiazepine |
| SMILES | CC1Cc2cc3c(cc2C(c2ccc([N+](=O)[O-])cc2)=NN1)COO3 |
| InChI | InChI=1S/C17H15N3O4/c1-10-6-12-8-16-13(9-23-24-16)7-15(12)17(19-18-10)11-2-4-14(5-3-11)20(21)22/h2-5,7-8,10,18H,6,9H2,1H3 |
| InChIKey | YCKROPDEHUHFIV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|