C20H16N4O5 — CID 19040697
3-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]-3-oxopropanenitrile (PubChem CID 19040697) has the molecular formula C20H16N4O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is 3-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]-3-oxopropanenitrile.
| Compound Name | 3-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 19040697 |
| Molecular Formula | C20H16N4O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]-3-oxopropanenitrile |
| SMILES | CC1Cc2cc3c(cc2C(c2ccc([N+](=O)[O-])cc2)=NN1C(=O)CC#N)COO3 |
| InChI | InChI=1S/C20H16N4O5/c1-12-8-14-10-18-15(11-28-29-18)9-17(14)20(22-23(12)19(25)6-7-21)13-2-4-16(5-3-13)24(26)27/h2-5,9-10,12H,6,8,11H2,1H3 |
| InChIKey | STSKKRRJAKMJAL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 118.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|