C19H16ClN3O5 — CID 19040722
2-chloro-1-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]ethanone (PubChem CID 19040722) has the molecular formula C19H16ClN3O5 and a molecular weight of 401.81 g/mol. Its IUPAC name is 2-chloro-1-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]ethanone.
| Compound Name | 2-chloro-1-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]ethanone |
|---|---|
| PubChem CID | 19040722 |
| Molecular Formula | C19H16ClN3O5 |
| Molecular Weight | 401.81 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 2-chloro-1-[8-methyl-5-(4-nitrophenyl)-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-7-yl]ethanone |
| SMILES | CC1Cc2cc3c(cc2C(c2ccc([N+](=O)[O-])cc2)=NN1C(=O)CCl)COO3 |
| InChI | InChI=1S/C19H16ClN3O5/c1-11-6-13-8-17-14(10-27-28-17)7-16(13)19(21-22(11)18(24)9-20)12-2-4-15(5-3-12)23(25)26/h2-5,7-8,11H,6,9-10H2,1H3 |
| InChIKey | OAEGBNIBBNWVNU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|