C21H21N3O4 — CID 19040723
N-[4-(7-formyl-8-methyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-5-yl)phenyl]propanamide (PubChem CID 19040723) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[4-(7-formyl-8-methyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-5-yl)phenyl]propanamide.
| Compound Name | N-[4-(7-formyl-8-methyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 19040723 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[4-(7-formyl-8-methyl-8,9-dihydro-3H-dioxolo[3,4-h][2,3]benzodiazepin-5-yl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C2=NN(C=O)C(C)Cc3cc4c(cc32)COO4)cc1 |
| InChI | InChI=1S/C21H21N3O4/c1-3-20(26)22-17-6-4-14(5-7-17)21-18-9-16-11-27-28-19(16)10-15(18)8-13(2)24(12-25)23-21/h4-7,9-10,12-13H,3,8,11H2,1-2H3,(H,22,26) |
| InChIKey | PHJDNFYDRTXBHZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|