About N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride
N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride (PubChem CID 19040897) has the molecular formula C21H26Cl2N4
and a molecular weight of 405.37 g/mol. Its IUPAC name is N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride.
Molecular Properties
| Compound Name | N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride |
| PubChem CID | 19040897 |
| Molecular Formula | C21H26Cl2N4 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride |
| SMILES | CCN(CC)Cc1cn2c3ccccc3n(Cc3ccccc3)c2n1.Cl.Cl |
| InChI | InChI=1S/C21H24N4.2ClH/c1-3-23(4-2)15-18-16-25-20-13-9-8-12-19(20)24(21(25)22-18)14-17-10-6-5-7-11-17;;/h5-13,16H,3-4,14-15H2,1-2H3;2*1H |
| InChIKey | BVUZAVRYJXIHBP-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 25.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride?
The IUPAC name of N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride (CID 19040897) is N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride.
What is the SMILES notation for N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride?
The canonical SMILES for N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride is CCN(CC)Cc1cn2c3ccccc3n(Cc3ccccc3)c2n1.Cl.Cl.
What is the InChIKey of N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride?
The InChIKey is BVUZAVRYJXIHBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4.2ClH/c1-3-23(4-2)15-18-16-25-20-13-9-8-12-19(20)24(21(25)22-18)14-17-10-6-5-7-11-17;;/h5-13,16H,3-4,14-15H2,1-2H3;2*1H.
What are the key properties of N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride?
N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride has a molecular weight of 405.37 g/mol, XLogP of 5.02, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-benzylimidazo[1,2-a]benzimidazol-2-yl)methyl]-N-ethylethanamine;dihydrochloride is sourced from PubChem (CID 19040897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).