About 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole
3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole (PubChem CID 19040937) has the molecular formula C24H29FN2O3
and a molecular weight of 412.51 g/mol. Its IUPAC name is 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole.
Molecular Properties
| Compound Name | 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole |
| PubChem CID | 19040937 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole |
| SMILES | CCc1ccc(OCCCN2CCC(c3onc4cc(F)ccc34)CC2)cc1OC |
| InChI | InChI=1S/C24H29FN2O3/c1-3-17-5-7-20(16-23(17)28-2)29-14-4-11-27-12-9-18(10-13-27)24-21-8-6-19(25)15-22(21)26-30-24/h5-8,15-16,18H,3-4,9-14H2,1-2H3 |
| InChIKey | BQVZORLDTGJAMH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole?
The IUPAC name of 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole (CID 19040937) is 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole.
What is the SMILES notation for 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole?
The canonical SMILES for 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole is CCc1ccc(OCCCN2CCC(c3onc4cc(F)ccc34)CC2)cc1OC.
What is the InChIKey of 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole?
The InChIKey is BQVZORLDTGJAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29FN2O3/c1-3-17-5-7-20(16-23(17)28-2)29-14-4-11-27-12-9-18(10-13-27)24-21-8-6-19(25)15-22(21)26-30-24/h5-8,15-16,18H,3-4,9-14H2,1-2H3.
What are the key properties of 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole?
3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole has a molecular weight of 412.51 g/mol, XLogP of 5.19, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[3-(4-ethyl-3-methoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-2,1-benzoxazole is sourced from PubChem (CID 19040937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).