About 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine
2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine (PubChem CID 19041087) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine |
| PubChem CID | 19041087 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine |
| SMILES | C1=CNC(n2cncn2)C=C1 |
| InChI | InChI=1S/C7H8N4/c1-2-4-9-7(3-1)11-6-8-5-10-11/h1-7,9H |
| InChIKey | VRFVRHAMOKOMDE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine?
The IUPAC name of 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine (CID 19041087) is 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine.
What is the SMILES notation for 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine?
The canonical SMILES for 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine is C1=CNC(n2cncn2)C=C1.
What is the InChIKey of 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine?
The InChIKey is VRFVRHAMOKOMDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-2-4-9-7(3-1)11-6-8-5-10-11/h1-7,9H.
What are the key properties of 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine?
2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine has a molecular weight of 148.17 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2,4-triazol-1-yl)-1,2-dihydropyridine is sourced from PubChem (CID 19041087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).