About 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole
2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole (PubChem CID 19041094) has the molecular formula C18H18N2O2S
and a molecular weight of 326.42 g/mol. Its IUPAC name is 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole |
| PubChem CID | 19041094 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole |
| SMILES | CCOc1ccc(-c2nc(-c3ccccn3)cs2)cc1OCC |
| InChI | InChI=1S/C18H18N2O2S/c1-3-21-16-9-8-13(11-17(16)22-4-2)18-20-15(12-23-18)14-7-5-6-10-19-14/h5-12H,3-4H2,1-2H3 |
| InChIKey | CZEHGQUTYNUGMM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole?
The IUPAC name of 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole (CID 19041094) is 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole.
What is the SMILES notation for 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole?
The canonical SMILES for 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole is CCOc1ccc(-c2nc(-c3ccccn3)cs2)cc1OCC.
What is the InChIKey of 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole?
The InChIKey is CZEHGQUTYNUGMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O2S/c1-3-21-16-9-8-13(11-17(16)22-4-2)18-20-15(12-23-18)14-7-5-6-10-19-14/h5-12H,3-4H2,1-2H3.
What are the key properties of 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole?
2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole has a molecular weight of 326.42 g/mol, XLogP of 4.67, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-diethoxyphenyl)-4-pyridin-2-yl-1,3-thiazole is sourced from PubChem (CID 19041094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).