C22H25N3O3S — CID 19041101
4-[6-[2-(3,4-Diethoxyphenyl)-1,3-thiazol-4-yl]-2-pyridinyl]morpholine (PubChem CID 19041101) has the molecular formula C22H25N3O3S and a molecular weight of 411.50 g/mol. Its IUPAC name is 4-[6-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-2-pyridinyl]morpholine.
| Compound Name | 4-[6-[2-(3,4-Diethoxyphenyl)-1,3-thiazol-4-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 19041101 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-[6-[2-(3,4-diethoxyphenyl)-1,3-thiazol-4-yl]-2-pyridinyl]morpholine |
| SMILES | CCOC1=C(C=C(C=C1)C2=NC(=CS2)C3=NC(=CC=C3)N4CCOCC4)OCC |
| InChI | InChI=1S/C22H25N3O3S/c1-3-27-19-9-8-16(14-20(19)28-4-2)22-24-18(15-29-22)17-6-5-7-21(23-17)25-10-12-26-13-11-25/h5-9,14-15H,3-4,10-13H2,1-2H3 |
| InChIKey | RNPIHEKTZWTQTF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 85.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | 494 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |