About 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide
4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide (PubChem CID 19041287) has the molecular formula C22H14F5N3O2S
and a molecular weight of 479.43 g/mol. Its IUPAC name is 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide |
| PubChem CID | 19041287 |
| Molecular Formula | C22H14F5N3O2S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2c(-c3ccc(F)cc3F)c(C(F)(F)F)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H14F5N3O2S/c23-14-8-11-17(18(24)12-14)19-20(13-6-9-16(10-7-13)33(28,31)32)30(15-4-2-1-3-5-15)29-21(19)22(25,26)27/h1-12H,(H2,28,31,32) |
| InChIKey | GGJKXIFALKLNGA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide?
The IUPAC name of 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide (CID 19041287) is 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide.
What is the SMILES notation for 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide?
The canonical SMILES for 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide is NS(=O)(=O)c1ccc(-c2c(-c3ccc(F)cc3F)c(C(F)(F)F)nn2-c2ccccc2)cc1.
What is the InChIKey of 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide?
The InChIKey is GGJKXIFALKLNGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14F5N3O2S/c23-14-8-11-17(18(24)12-14)19-20(13-6-9-16(10-7-13)33(28,31)32)30(15-4-2-1-3-5-15)29-21(19)22(25,26)27/h1-12H,(H2,28,31,32).
What are the key properties of 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide?
4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide has a molecular weight of 479.43 g/mol, XLogP of 5.15, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2,4-difluorophenyl)-1-phenyl-3-(trifluoromethyl)pyrazol-5-yl]benzenesulfonamide is sourced from PubChem (CID 19041287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).