About 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide
4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide (PubChem CID 19041425) has the molecular formula C22H17F2N3O4S
and a molecular weight of 457.46 g/mol. Its IUPAC name is 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide |
| PubChem CID | 19041425 |
| Molecular Formula | C22H17F2N3O4S |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2c(-c3ccc(O)cc3)c(C(F)F)nn2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H17F2N3O4S/c23-22(24)20-19(13-1-7-16(28)8-2-13)21(14-3-11-18(12-4-14)32(25,30)31)27(26-20)15-5-9-17(29)10-6-15/h1-12,22,28-29H,(H2,25,30,31) |
| InChIKey | VWOUYMAUCPBIID-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide?
The IUPAC name of 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide (CID 19041425) is 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide.
What is the SMILES notation for 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide?
The canonical SMILES for 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide is NS(=O)(=O)c1ccc(-c2c(-c3ccc(O)cc3)c(C(F)F)nn2-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide?
The InChIKey is VWOUYMAUCPBIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17F2N3O4S/c23-22(24)20-19(13-1-7-16(28)8-2-13)21(14-3-11-18(12-4-14)32(25,30)31)27(26-20)15-5-9-17(29)10-6-15/h1-12,22,28-29H,(H2,25,30,31).
What are the key properties of 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide?
4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide has a molecular weight of 457.46 g/mol, XLogP of 4.20, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(difluoromethyl)-1,4-bis(4-hydroxyphenyl)pyrazol-5-yl]benzenesulfonamide is sourced from PubChem (CID 19041425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).