About N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine
N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine (PubChem CID 19041541) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine.
Molecular Properties
| Compound Name | N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine |
| PubChem CID | 19041541 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine |
| SMILES | CCCN(CCC)C1Cc2cc3ccoc3cc2C1 |
| InChI | InChI=1S/C17H23NO/c1-3-6-18(7-4-2)16-10-14-9-13-5-8-19-17(13)12-15(14)11-16/h5,8-9,12,16H,3-4,6-7,10-11H2,1-2H3 |
| InChIKey | ZACCFGQTAXOCFF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine?
The IUPAC name of N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine (CID 19041541) is N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine.
What is the SMILES notation for N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine?
The canonical SMILES for N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine is CCCN(CCC)C1Cc2cc3ccoc3cc2C1.
What is the InChIKey of N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine?
The InChIKey is ZACCFGQTAXOCFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO/c1-3-6-18(7-4-2)16-10-14-9-13-5-8-19-17(13)12-15(14)11-16/h5,8-9,12,16H,3-4,6-7,10-11H2,1-2H3.
What are the key properties of N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine?
N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine has a molecular weight of 257.38 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dipropyl-6,7-dihydro-5H-cyclopenta[f][1]benzofuran-6-amine is sourced from PubChem (CID 19041541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).