C15H26Cl2N2O — CID 19041574
3-N,3-N-dipropyl-3,4-dihydro-2H-chromene-3,8-diamine;dihydrochloride (PubChem CID 19041574) has the molecular formula C15H26Cl2N2O and a molecular weight of 321.29 g/mol. Its IUPAC name is 3-N,3-N-dipropyl-3,4-dihydro-2H-chromene-3,8-diamine;dihydrochloride.
| Compound Name | 3-N,3-N-dipropyl-3,4-dihydro-2H-chromene-3,8-diamine;dihydrochloride |
|---|---|
| PubChem CID | 19041574 |
| Molecular Formula | C15H26Cl2N2O |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-N,3-N-dipropyl-3,4-dihydro-2H-chromene-3,8-diamine;dihydrochloride |
| SMILES | CCCN(CCC)C1COc2c(N)cccc2C1.Cl.Cl |
| InChI | InChI=1S/C15H24N2O.2ClH/c1-3-8-17(9-4-2)13-10-12-6-5-7-14(16)15(12)18-11-13;;/h5-7,13H,3-4,8-11,16H2,1-2H3;2*1H |
| InChIKey | BWYNBSLRYUQZJJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|