About ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate
ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate (PubChem CID 19041716) has the molecular formula C25H30BrNO3
and a molecular weight of 472.42 g/mol. Its IUPAC name is ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate |
| PubChem CID | 19041716 |
| Molecular Formula | C25H30BrNO3 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate |
| SMILES | CCOC(=O)C(C)(C)CCc1c(C)n(Cc2ccc(Br)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C25H30BrNO3/c1-6-30-24(28)25(3,4)14-13-21-17(2)27(16-18-7-9-19(26)10-8-18)23-12-11-20(29-5)15-22(21)23/h7-12,15H,6,13-14,16H2,1-5H3 |
| InChIKey | SLYLTOFQSJXMRV-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate?
The IUPAC name of ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate (CID 19041716) is ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate.
What is the SMILES notation for ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate?
The canonical SMILES for ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate is CCOC(=O)C(C)(C)CCc1c(C)n(Cc2ccc(Br)cc2)c2ccc(OC)cc12.
What is the InChIKey of ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate?
The InChIKey is SLYLTOFQSJXMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H30BrNO3/c1-6-30-24(28)25(3,4)14-13-21-17(2)27(16-18-7-9-19(26)10-8-18)23-12-11-20(29-5)15-22(21)23/h7-12,15H,6,13-14,16H2,1-5H3.
What are the key properties of ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate?
ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate has a molecular weight of 472.42 g/mol, XLogP of 6.29, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2,2-dimethylbutanoate is sourced from PubChem (CID 19041716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).