About phenanthrene-1,2-dicarbonitrile
phenanthrene-1,2-dicarbonitrile (PubChem CID 19041876) has the molecular formula C16H8N2
and a molecular weight of 228.25 g/mol. Its IUPAC name is phenanthrene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | phenanthrene-1,2-dicarbonitrile |
| PubChem CID | 19041876 |
| Molecular Formula | C16H8N2 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | phenanthrene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc2c(ccc3ccccc32)c1C#N |
| InChI | InChI=1S/C16H8N2/c17-9-12-6-8-14-13-4-2-1-3-11(13)5-7-15(14)16(12)10-18/h1-8H |
| InChIKey | SFIJSYCLQIAHQB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene-1,2-dicarbonitrile?
The IUPAC name of phenanthrene-1,2-dicarbonitrile (CID 19041876) is phenanthrene-1,2-dicarbonitrile.
What is the SMILES notation for phenanthrene-1,2-dicarbonitrile?
The canonical SMILES for phenanthrene-1,2-dicarbonitrile is N#Cc1ccc2c(ccc3ccccc32)c1C#N.
What is the InChIKey of phenanthrene-1,2-dicarbonitrile?
The InChIKey is SFIJSYCLQIAHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8N2/c17-9-12-6-8-14-13-4-2-1-3-11(13)5-7-15(14)16(12)10-18/h1-8H.
What are the key properties of phenanthrene-1,2-dicarbonitrile?
phenanthrene-1,2-dicarbonitrile has a molecular weight of 228.25 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene-1,2-dicarbonitrile is sourced from PubChem (CID 19041876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).