C16H18N4O5 — CID 19041926
5,10-dimethoxy-2-(methoxymethyl)-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione (PubChem CID 19041926) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 5,10-dimethoxy-2-(methoxymethyl)-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione.
| Compound Name | 5,10-dimethoxy-2-(methoxymethyl)-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione |
|---|---|
| PubChem CID | 19041926 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 5,10-dimethoxy-2-(methoxymethyl)-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione |
| SMILES | COCc1nc2c(OC)c3c(=O)n(C)cnc3c(OC)c2c(=O)n1C |
| InChI | InChI=1S/C16H18N4O5/c1-19-7-17-11-9(15(19)21)14(25-5)12-10(13(11)24-4)16(22)20(2)8(18-12)6-23-3/h7H,6H2,1-5H3 |
| InChIKey | OGVMTNOVWYKGNH-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 97.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|