C15H15BrN4O4 — CID 19041928
2-(bromomethyl)-5,10-dimethoxy-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione (PubChem CID 19041928) has the molecular formula C15H15BrN4O4 and a molecular weight of 395.21 g/mol. Its IUPAC name is 2-(bromomethyl)-5,10-dimethoxy-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione.
| Compound Name | 2-(bromomethyl)-5,10-dimethoxy-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione |
|---|---|
| PubChem CID | 19041928 |
| Molecular Formula | C15H15BrN4O4 |
| Molecular Weight | 395.21 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 2-(bromomethyl)-5,10-dimethoxy-3,8-dimethylpyrimido[4,5-g]quinazoline-4,9-dione |
| SMILES | COc1c2nc(CBr)n(C)c(=O)c2c(OC)c2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C15H15BrN4O4/c1-19-6-17-10-8(14(19)21)13(24-4)11-9(12(10)23-3)15(22)20(2)7(5-16)18-11/h6H,5H2,1-4H3 |
| InChIKey | JUSZWZJILYAIOV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|