About pentan-3-ylcyclopropane
pentan-3-ylcyclopropane (PubChem CID 19042038) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is pentan-3-ylcyclopropane.
Molecular Properties
| Compound Name | pentan-3-ylcyclopropane |
| PubChem CID | 19042038 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | pentan-3-ylcyclopropane |
| SMILES | CCC(CC)C1CC1 |
| InChI | InChI=1S/C8H16/c1-3-7(4-2)8-5-6-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | IHAKTQBKPPJHSV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentan-3-ylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-3-ylcyclopropane?
The IUPAC name of pentan-3-ylcyclopropane (CID 19042038) is pentan-3-ylcyclopropane.
What is the SMILES notation for pentan-3-ylcyclopropane?
The canonical SMILES for pentan-3-ylcyclopropane is CCC(CC)C1CC1.
What is the InChIKey of pentan-3-ylcyclopropane?
The InChIKey is IHAKTQBKPPJHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16/c1-3-7(4-2)8-5-6-8/h7-8H,3-6H2,1-2H3.
What are the key properties of pentan-3-ylcyclopropane?
pentan-3-ylcyclopropane has a molecular weight of 112.22 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-3-ylcyclopropane is sourced from PubChem (CID 19042038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).