C32H36N2O4S — CID 19042107
2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyl-7-(5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-yl)heptanenitrile (PubChem CID 19042107) has the molecular formula C32H36N2O4S and a molecular weight of 544.72 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyl-7-(5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-yl)heptanenitrile.
| Compound Name | 2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyl-7-(5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-yl)heptanenitrile |
|---|---|
| PubChem CID | 19042107 |
| Molecular Formula | C32H36N2O4S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-2-(4-methylphenyl)sulfanyl-7-(5,6,7,8-tetrahydro-[1,3]dioxolo[4,5-g]quinolin-6-yl)heptanenitrile |
| SMILES | COc1ccc(C(C#N)(CCCCCC2CCc3cc4c(cc3N2)OCO4)Sc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C32H36N2O4S/c1-22-8-13-26(14-9-22)39-32(20-33,24-11-15-28(35-2)29(18-24)36-3)16-6-4-5-7-25-12-10-23-17-30-31(38-21-37-30)19-27(23)34-25/h8-9,11,13-15,17-19,25,34H,4-7,10,12,16,21H2,1-3H3 |
| InChIKey | RKQULNHNERZDSW-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 72.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|