C11H15NNaO2+ — CID 19042259
sodium N-(2,6-dimethylphenyl)-2-methoxyacetamide (PubChem CID 19042259) has the molecular formula C11H15NNaO2+ and a molecular weight of 216.24 g/mol. Its IUPAC name is sodium N-(2,6-dimethylphenyl)-2-methoxyacetamide.
| Compound Name | sodium N-(2,6-dimethylphenyl)-2-methoxyacetamide |
|---|---|
| PubChem CID | 19042259 |
| Molecular Formula | C11H15NNaO2+ |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | sodium N-(2,6-dimethylphenyl)-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1c(C)cccc1C.[Na+] |
| InChI | InChI=1S/C11H15NO2.Na/c1-8-5-4-6-9(2)11(8)12-10(13)7-14-3;/h4-6H,7H2,1-3H3,(H,12,13);/q;+1 |
| InChIKey | IDTBIBPLRRJJSR-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |