About 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile
3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile (PubChem CID 19042303) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile.
Molecular Properties
| Compound Name | 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile |
| PubChem CID | 19042303 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile |
| SMILES | CC1CC(=O)c2cccc(C#N)c21 |
| InChI | InChI=1S/C11H9NO/c1-7-5-10(13)9-4-2-3-8(6-12)11(7)9/h2-4,7H,5H2,1H3 |
| InChIKey | MPJOZHAVOQLQEJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile?
The IUPAC name of 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile (CID 19042303) is 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile.
What is the SMILES notation for 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile?
The canonical SMILES for 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile is CC1CC(=O)c2cccc(C#N)c21.
What is the InChIKey of 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile?
The InChIKey is MPJOZHAVOQLQEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c1-7-5-10(13)9-4-2-3-8(6-12)11(7)9/h2-4,7H,5H2,1H3.
What are the key properties of 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile?
3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile has a molecular weight of 171.20 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-oxo-2,3-dihydroindene-4-carbonitrile is sourced from PubChem (CID 19042303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).