C14H26S — CID 19043507
3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene (PubChem CID 19043507) has the molecular formula C14H26S and a molecular weight of 226.43 g/mol. Its IUPAC name is 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene.
| Compound Name | 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene |
|---|---|
| PubChem CID | 19043507 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene |
| SMILES | C=CC(SC(C=C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26S/c1-9-11(13(3,4)5)15-12(10-2)14(6,7)8/h9-12H,1-2H2,3-8H3 |
| InChIKey | BBZXLOSPPZPKKZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|