About 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene
3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene (PubChem CID 19043507) has the molecular formula C14H26S
and a molecular weight of 226.43 g/mol. Its IUPAC name is 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene.
Molecular Properties
| Compound Name | 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene |
| PubChem CID | 19043507 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene |
| SMILES | C=CC(SC(C=C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H26S/c1-9-11(13(3,4)5)15-12(10-2)14(6,7)8/h9-12H,1-2H2,3-8H3 |
| InChIKey | BBZXLOSPPZPKKZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene?
The IUPAC name of 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene (CID 19043507) is 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene.
What is the SMILES notation for 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene?
The canonical SMILES for 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene is C=CC(SC(C=C)C(C)(C)C)C(C)(C)C.
What is the InChIKey of 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene?
The InChIKey is BBZXLOSPPZPKKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26S/c1-9-11(13(3,4)5)15-12(10-2)14(6,7)8/h9-12H,1-2H2,3-8H3.
What are the key properties of 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene?
3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene has a molecular weight of 226.43 g/mol, XLogP of 4.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,4-dimethylpent-1-en-3-ylsulfanyl)-4,4-dimethylpent-1-ene is sourced from PubChem (CID 19043507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).