About 2-methylpropanamide;dihydrate
2-methylpropanamide;dihydrate (PubChem CID 19043645) has the molecular formula C4H13NO3
and a molecular weight of 123.15 g/mol. Its IUPAC name is 2-methylpropanamide;dihydrate.
Molecular Properties
| Compound Name | 2-methylpropanamide;dihydrate |
| PubChem CID | 19043645 |
| Molecular Formula | C4H13NO3 |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | 2-methylpropanamide;dihydrate |
| SMILES | CC(C)C(N)=O.O.O |
| InChI | InChI=1S/C4H9NO.2H2O/c1-3(2)4(5)6;;/h3H,1-2H3,(H2,5,6);2*1H2 |
| InChIKey | PDYXVZHOLWKKTM-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropanamide;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanamide;dihydrate?
The IUPAC name of 2-methylpropanamide;dihydrate (CID 19043645) is 2-methylpropanamide;dihydrate.
What is the SMILES notation for 2-methylpropanamide;dihydrate?
The canonical SMILES for 2-methylpropanamide;dihydrate is CC(C)C(N)=O.O.O.
What is the InChIKey of 2-methylpropanamide;dihydrate?
The InChIKey is PDYXVZHOLWKKTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.2H2O/c1-3(2)4(5)6;;/h3H,1-2H3,(H2,5,6);2*1H2.
What are the key properties of 2-methylpropanamide;dihydrate?
2-methylpropanamide;dihydrate has a molecular weight of 123.15 g/mol, XLogP of -1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanamide;dihydrate is sourced from PubChem (CID 19043645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).